C10H9NO3 — CID 22595325
(E)-3-(1-cyano-4-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid (PubChem CID 22595325) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is (E)-3-(1-cyano-4-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(1-cyano-4-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 22595325 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (E)-3-(1-cyano-4-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid |
| SMILES | N#CC1(/C=C/C(=O)O)C=CC(O)=CC1 |
| InChI | InChI=1S/C10H9NO3/c11-7-10(6-3-9(13)14)4-1-8(12)2-5-10/h1-4,6,12H,5H2,(H,13,14)/b6-3+ |
| InChIKey | ISPSCRIPINTHFK-ZZXKWVIFSA-N |
| XLogP | 1.54 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|