C13H14O5 — CID 141380895
bis(1,4-dihydroxycyclohexa-2,4-dien-1-yl)methanone (PubChem CID 141380895) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is bis(1,4-dihydroxycyclohexa-2,4-dien-1-yl)methanone.
| Compound Name | bis(1,4-dihydroxycyclohexa-2,4-dien-1-yl)methanone |
|---|---|
| PubChem CID | 141380895 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | bis(1,4-dihydroxycyclohexa-2,4-dien-1-yl)methanone |
| SMILES | O=C(C1(O)C=CC(O)=CC1)C1(O)C=CC(O)=CC1 |
| InChI | InChI=1S/C13H14O5/c14-9-1-5-12(17,6-2-9)11(16)13(18)7-3-10(15)4-8-13/h1-5,7,14-15,17-18H,6,8H2 |
| InChIKey | SQBSRWJVBVTJDF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |