C10H14O2 — CID 67682803
1-[(1S)-1-hydroxycyclohexa-2,4-dien-1-yl]butan-1-one (PubChem CID 67682803) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-[(1S)-1-hydroxycyclohexa-2,4-dien-1-yl]butan-1-one.
| Compound Name | 1-[(1S)-1-hydroxycyclohexa-2,4-dien-1-yl]butan-1-one |
|---|---|
| PubChem CID | 67682803 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-[(1S)-1-hydroxycyclohexa-2,4-dien-1-yl]butan-1-one |
| SMILES | CCCC(=O)[C@@]1(O)C=CC=CC1 |
| InChI | InChI=1S/C10H14O2/c1-2-6-9(11)10(12)7-4-3-5-8-10/h3-5,7,12H,2,6,8H2,1H3/t10-/m1/s1 |
| InChIKey | DXNDIMOQYQLENW-SNVBAGLBSA-N |
| XLogP | 1.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |