C14H24O — CID 150421507
4-butyl-4-tert-butylcyclohexa-1,5-dien-1-ol (PubChem CID 150421507) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 4-butyl-4-tert-butylcyclohexa-1,5-dien-1-ol.
| Compound Name | 4-butyl-4-tert-butylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 150421507 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 4-butyl-4-tert-butylcyclohexa-1,5-dien-1-ol |
| SMILES | CCCCC1(C(C)(C)C)C=CC(O)=CC1 |
| InChI | InChI=1S/C14H24O/c1-5-6-9-14(13(2,3)4)10-7-12(15)8-11-14/h7-8,10,15H,5-6,9,11H2,1-4H3 |
| InChIKey | HHWPJZFAGLFHFA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |