C7H8O2 — CID 155666685
6-methyl-7-oxabicyclo[4.1.0]hepta-2,4-dien-3-ol (PubChem CID 155666685) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is 6-methyl-7-oxabicyclo[4.1.0]hepta-2,4-dien-3-ol.
| Compound Name | 6-methyl-7-oxabicyclo[4.1.0]hepta-2,4-dien-3-ol |
|---|---|
| PubChem CID | 155666685 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 6-methyl-7-oxabicyclo[4.1.0]hepta-2,4-dien-3-ol |
| SMILES | CC12C=CC(O)=CC1O2 |
| InChI | InChI=1S/C7H8O2/c1-7-3-2-5(8)4-6(7)9-7/h2-4,6,8H,1H3 |
| InChIKey | WFVZVVZAGIFLBQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|