C9H12O3 — CID 156700477
4,5-dimethoxy-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 156700477) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 4,5-dimethoxy-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 4,5-dimethoxy-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 156700477 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 4,5-dimethoxy-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | COC1=C(OC)C2OC2(C)C=C1 |
| InChI | InChI=1S/C9H12O3/c1-9-5-4-6(10-2)7(11-3)8(9)12-9/h4-5,8H,1-3H3 |
| InChIKey | PKTMHLXLDBTBNP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|