C7H7ClO — CID 141176231
5-chloro-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 141176231) has the molecular formula C7H7ClO and a molecular weight of 142.59 g/mol. Its IUPAC name is 5-chloro-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 5-chloro-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 141176231 |
| Molecular Formula | C7H7ClO |
| Molecular Weight | 142.59 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | 5-chloro-1-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC12C=CC=C(Cl)C1O2 |
| InChI | InChI=1S/C7H7ClO/c1-7-4-2-3-5(8)6(7)9-7/h2-4,6H,1H3 |
| InChIKey | WKRZNJVEISBCIG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|