C11H13N — CID 155419679
5,8a-dimethyl-4aH-quinoline (PubChem CID 155419679) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 5,8a-dimethyl-4aH-quinoline.
| Compound Name | 5,8a-dimethyl-4aH-quinoline |
|---|---|
| PubChem CID | 155419679 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 5,8a-dimethyl-4aH-quinoline |
| SMILES | CC1=CC=CC2(C)N=CC=CC12 |
| InChI | InChI=1S/C11H13N/c1-9-5-3-7-11(2)10(9)6-4-8-12-11/h3-8,10H,1-2H3 |
| InChIKey | JPGAEBVRYNDZPV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |