About 2,2-dimethylpyrrole;ruthenium
2,2-dimethylpyrrole;ruthenium (PubChem CID 174567335) has the molecular formula C6H9NRu
and a molecular weight of 196.22 g/mol. Its IUPAC name is 2,2-dimethylpyrrole;ruthenium.
Molecular Properties
| Compound Name | 2,2-dimethylpyrrole;ruthenium |
| PubChem CID | 174567335 |
| Molecular Formula | C6H9NRu |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.98 |
| IUPAC Name | 2,2-dimethylpyrrole;ruthenium |
| SMILES | CC1(C)C=CC=N1.[Ru] |
| InChI | InChI=1S/C6H9N.Ru/c1-6(2)4-3-5-7-6;/h3-5H,1-2H3; |
| InChIKey | XQHKMCHQUNSZHF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethylpyrrole;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpyrrole;ruthenium?
The IUPAC name of 2,2-dimethylpyrrole;ruthenium (CID 174567335) is 2,2-dimethylpyrrole;ruthenium.
What is the SMILES notation for 2,2-dimethylpyrrole;ruthenium?
The canonical SMILES for 2,2-dimethylpyrrole;ruthenium is CC1(C)C=CC=N1.[Ru].
What is the InChIKey of 2,2-dimethylpyrrole;ruthenium?
The InChIKey is XQHKMCHQUNSZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.Ru/c1-6(2)4-3-5-7-6;/h3-5H,1-2H3;.
What are the key properties of 2,2-dimethylpyrrole;ruthenium?
2,2-dimethylpyrrole;ruthenium has a molecular weight of 196.22 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpyrrole;ruthenium is sourced from PubChem (CID 174567335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).