C16H19N3O3 — CID 129170692
(3S)-3-(2,5,8a-trimethyl-4-oxo-4aH-quinazolin-3-yl)piperidine-2,6-dione (PubChem CID 129170692) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (3S)-3-(2,5,8a-trimethyl-4-oxo-4aH-quinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | (3S)-3-(2,5,8a-trimethyl-4-oxo-4aH-quinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 129170692 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (3S)-3-(2,5,8a-trimethyl-4-oxo-4aH-quinazolin-3-yl)piperidine-2,6-dione |
| SMILES | CC1=CC=CC2(C)N=C(C)N([C@H]3CCC(=O)NC3=O)C(=O)C12 |
| InChI | InChI=1S/C16H19N3O3/c1-9-5-4-8-16(3)13(9)15(22)19(10(2)18-16)11-6-7-12(20)17-14(11)21/h4-5,8,11,13H,6-7H2,1-3H3,(H,17,20,21)/t11-,13?,16?/m0/s1 |
| InChIKey | XVJPFVQTZMCYJT-XOMBGVMMSA-N |
| XLogP | 0.94 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|