C19H22N2O7 — CID 138696454
2-[[4-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-3aH-isoindol-4-yl]oxy]acetic acid (PubChem CID 138696454) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-[[4-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-3aH-isoindol-4-yl]oxy]acetic acid.
| Compound Name | 2-[[4-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-3aH-isoindol-4-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 138696454 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[[4-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-3aH-isoindol-4-yl]oxy]acetic acid |
| SMILES | CC(C)(C)C1(OCC(=O)O)C=CC=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)C21 |
| InChI | InChI=1S/C19H22N2O7/c1-18(2,3)19(28-9-13(23)24)8-4-5-10-14(19)17(27)21(16(10)26)11-6-7-12(22)20-15(11)25/h4-5,8,11,14H,6-7,9H2,1-3H3,(H,23,24)(H,20,22,25) |
| InChIKey | ILVCOYJGLVJWGF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|