C8H10Cl2O — CID 154271946
2,6-dichloro-6-ethylcyclohexa-2,4-dien-1-ol (PubChem CID 154271946) has the molecular formula C8H10Cl2O and a molecular weight of 193.07 g/mol. Its IUPAC name is 2,6-dichloro-6-ethylcyclohexa-2,4-dien-1-ol.
| Compound Name | 2,6-dichloro-6-ethylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 154271946 |
| Molecular Formula | C8H10Cl2O |
| Molecular Weight | 193.07 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 2,6-dichloro-6-ethylcyclohexa-2,4-dien-1-ol |
| SMILES | CCC1(Cl)C=CC=C(Cl)C1O |
| InChI | InChI=1S/C8H10Cl2O/c1-2-8(10)5-3-4-6(9)7(8)11/h3-5,7,11H,2H2,1H3 |
| InChIKey | WFFZLIWPQRJMPA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.07 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|