C8H11ClO — CID 175335226
(1S)-6-chloro-1-ethylcyclohexa-2,4-dien-1-ol (PubChem CID 175335226) has the molecular formula C8H11ClO and a molecular weight of 158.63 g/mol. Its IUPAC name is (1S)-6-chloro-1-ethylcyclohexa-2,4-dien-1-ol.
| Compound Name | (1S)-6-chloro-1-ethylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 175335226 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (1S)-6-chloro-1-ethylcyclohexa-2,4-dien-1-ol |
| SMILES | CC[C@]1(O)C=CC=CC1Cl |
| InChI | InChI=1S/C8H11ClO/c1-2-8(10)6-4-3-5-7(8)9/h3-7,10H,2H2,1H3/t7?,8-/m0/s1 |
| InChIKey | PJXWGYSCCSCVBF-MQWKRIRWSA-N |
| XLogP | 1.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|