C8H10ClNO — CID 150992639
6-chloro-1-methylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 150992639) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is 6-chloro-1-methylcyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-chloro-1-methylcyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 150992639 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 6-chloro-1-methylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | CC1(C(N)=O)C=CC=CC1Cl |
| InChI | InChI=1S/C8H10ClNO/c1-8(7(10)11)5-3-2-4-6(8)9/h2-6H,1H3,(H2,10,11) |
| InChIKey | LSLBORUZSGZOSI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|