C12H10Cl4S2 — CID 175564922
5,6-dichloro-5-[(1,6-dichlorocyclohexa-2,4-dien-1-yl)disulfanyl]cyclohexa-1,3-diene (PubChem CID 175564922) has the molecular formula C12H10Cl4S2 and a molecular weight of 360.16 g/mol. Its IUPAC name is 5,6-dichloro-5-[(1,6-dichlorocyclohexa-2,4-dien-1-yl)disulfanyl]cyclohexa-1,3-diene.
| Compound Name | 5,6-dichloro-5-[(1,6-dichlorocyclohexa-2,4-dien-1-yl)disulfanyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175564922 |
| Molecular Formula | C12H10Cl4S2 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 357.90 |
| IUPAC Name | 5,6-dichloro-5-[(1,6-dichlorocyclohexa-2,4-dien-1-yl)disulfanyl]cyclohexa-1,3-diene |
| SMILES | ClC1C=CC=CC1(Cl)SSC1(Cl)C=CC=CC1Cl |
| InChI | InChI=1S/C12H10Cl4S2/c13-9-5-1-3-7-11(9,15)17-18-12(16)8-4-2-6-10(12)14/h1-10H |
| InChIKey | XOPRMWFFDFYWBM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|