C6H5Cl2NaO3S — CID 159222808
sodium 1,6-dichlorocyclohexa-2,4-diene-1-sulfonate (PubChem CID 159222808) has the molecular formula C6H5Cl2NaO3S and a molecular weight of 251.07 g/mol. Its IUPAC name is sodium 1,6-dichlorocyclohexa-2,4-diene-1-sulfonate.
| Compound Name | sodium 1,6-dichlorocyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 159222808 |
| Molecular Formula | C6H5Cl2NaO3S |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 249.92 |
| IUPAC Name | sodium 1,6-dichlorocyclohexa-2,4-diene-1-sulfonate |
| SMILES | O=S(=O)([O-])C1(Cl)C=CC=CC1Cl.[Na+] |
| InChI | InChI=1S/C6H6Cl2O3S.Na/c7-5-3-1-2-4-6(5,8)12(9,10)11;/h1-5H,(H,9,10,11);/q;+1/p-1 |
| InChIKey | KRXHRWDHXLYTOX-UHFFFAOYSA-M |
| XLogP | -1.80 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|