C12H23NO3S — CID 155713195
1,6-dimethylcyclohexa-2,4-diene-1-sulfonate;tetramethylazanium (PubChem CID 155713195) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate;tetramethylazanium.
| Compound Name | 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate;tetramethylazanium |
|---|---|
| PubChem CID | 155713195 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate;tetramethylazanium |
| SMILES | CC1C=CC=CC1(C)S(=O)(=O)[O-].C[N+](C)(C)C |
| InChI | InChI=1S/C8H12O3S.C4H12N/c1-7-5-3-4-6-8(7,2)12(9,10)11;1-5(2,3)4/h3-7H,1-2H3,(H,9,10,11);1-4H3/q;+1/p-1 |
| InChIKey | MWDDHFDRDIDFGK-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|