C12H19NO6S — CID 141183010
(3-hydroxy-2-methyl-2-nitropropyl) 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate (PubChem CID 141183010) has the molecular formula C12H19NO6S and a molecular weight of 305.35 g/mol. Its IUPAC name is (3-hydroxy-2-methyl-2-nitropropyl) 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate.
| Compound Name | (3-hydroxy-2-methyl-2-nitropropyl) 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 141183010 |
| Molecular Formula | C12H19NO6S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (3-hydroxy-2-methyl-2-nitropropyl) 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate |
| SMILES | CC1C=CC=CC1(C)S(=O)(=O)OCC(C)(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C12H19NO6S/c1-10-6-4-5-7-12(10,3)20(17,18)19-9-11(2,8-14)13(15)16/h4-7,10,14H,8-9H2,1-3H3 |
| InChIKey | YHVCWJOUIRIUEG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|