C11H18O2S — CID 141073371
5,6-dimethyl-5-propylsulfonylcyclohexa-1,3-diene (PubChem CID 141073371) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 5,6-dimethyl-5-propylsulfonylcyclohexa-1,3-diene.
| Compound Name | 5,6-dimethyl-5-propylsulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141073371 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5,6-dimethyl-5-propylsulfonylcyclohexa-1,3-diene |
| SMILES | CCCS(=O)(=O)C1(C)C=CC=CC1C |
| InChI | InChI=1S/C11H18O2S/c1-4-9-14(12,13)11(3)8-6-5-7-10(11)2/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | CHAHCNWVRZIOOG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |