C19H25ClO2S — CID 166517162
1-tert-butyl-4-[2-(1-chloro-6-methylcyclohexa-2,4-dien-1-yl)sulfonylethyl]benzene (PubChem CID 166517162) has the molecular formula C19H25ClO2S and a molecular weight of 352.93 g/mol. Its IUPAC name is 1-tert-butyl-4-[2-(1-chloro-6-methylcyclohexa-2,4-dien-1-yl)sulfonylethyl]benzene.
| Compound Name | 1-tert-butyl-4-[2-(1-chloro-6-methylcyclohexa-2,4-dien-1-yl)sulfonylethyl]benzene |
|---|---|
| PubChem CID | 166517162 |
| Molecular Formula | C19H25ClO2S |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-tert-butyl-4-[2-(1-chloro-6-methylcyclohexa-2,4-dien-1-yl)sulfonylethyl]benzene |
| SMILES | CC1C=CC=CC1(Cl)S(=O)(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H25ClO2S/c1-15-7-5-6-13-19(15,20)23(21,22)14-12-16-8-10-17(11-9-16)18(2,3)4/h5-11,13,15H,12,14H2,1-4H3 |
| InChIKey | ZCMUQWFZORVCEZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|