C13H16Cl3NO — CID 15830436
2-tert-butyl-4,4,10-trichloro-2-azaspiro[4.5]deca-6,8-dien-3-one (PubChem CID 15830436) has the molecular formula C13H16Cl3NO and a molecular weight of 308.64 g/mol. Its IUPAC name is 2-tert-butyl-4,4,10-trichloro-2-azaspiro[4.5]deca-6,8-dien-3-one.
| Compound Name | 2-tert-butyl-4,4,10-trichloro-2-azaspiro[4.5]deca-6,8-dien-3-one |
|---|---|
| PubChem CID | 15830436 |
| Molecular Formula | C13H16Cl3NO |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-tert-butyl-4,4,10-trichloro-2-azaspiro[4.5]deca-6,8-dien-3-one |
| SMILES | CC(C)(C)N1CC2(C=CC=CC2Cl)C(Cl)(Cl)C1=O |
| InChI | InChI=1S/C13H16Cl3NO/c1-11(2,3)17-8-12(13(15,16)10(17)18)7-5-4-6-9(12)14/h4-7,9H,8H2,1-3H3 |
| InChIKey | UXPGTJNMFOLGRQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|