C15H18O3 — CID 175091803
1-ethyl-6-(2-methoxyphenoxy)cyclohexa-2,4-dien-1-ol (PubChem CID 175091803) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-ethyl-6-(2-methoxyphenoxy)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1-ethyl-6-(2-methoxyphenoxy)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 175091803 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-ethyl-6-(2-methoxyphenoxy)cyclohexa-2,4-dien-1-ol |
| SMILES | CCC1(O)C=CC=CC1Oc1ccccc1OC |
| InChI | InChI=1S/C15H18O3/c1-3-15(16)11-7-6-10-14(15)18-13-9-5-4-8-12(13)17-2/h4-11,14,16H,3H2,1-2H3 |
| InChIKey | QRIQHHMAKBOSRB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |