C15H16Br2O — CID 150832897
1-(2-bromoethyl)-2-(6-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxybenzene (PubChem CID 150832897) has the molecular formula C15H16Br2O and a molecular weight of 372.10 g/mol. Its IUPAC name is 1-(2-bromoethyl)-2-(6-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxybenzene.
| Compound Name | 1-(2-bromoethyl)-2-(6-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxybenzene |
|---|---|
| PubChem CID | 150832897 |
| Molecular Formula | C15H16Br2O |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 1-(2-bromoethyl)-2-(6-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxybenzene |
| SMILES | CC1(Br)C=CC=CC1Oc1ccccc1CCBr |
| InChI | InChI=1S/C15H16Br2O/c1-15(17)10-5-4-8-14(15)18-13-7-3-2-6-12(13)9-11-16/h2-8,10,14H,9,11H2,1H3 |
| InChIKey | KMIPTDHJTWGWIV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|