C11H12Cl2O2 — CID 116864108
3-(2,3-dichloro-4-methoxyphenyl)-2,2-dimethyloxirane (PubChem CID 116864108) has the molecular formula C11H12Cl2O2 and a molecular weight of 247.12 g/mol. Its IUPAC name is 3-(2,3-dichloro-4-methoxyphenyl)-2,2-dimethyloxirane.
| Compound Name | 3-(2,3-dichloro-4-methoxyphenyl)-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 116864108 |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 3-(2,3-dichloro-4-methoxyphenyl)-2,2-dimethyloxirane |
| SMILES | COc1ccc(C2OC2(C)C)c(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl2O2/c1-11(2)10(15-11)6-4-5-7(14-3)9(13)8(6)12/h4-5,10H,1-3H3 |
| InChIKey | KOWAWCXIIIDPKW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|