C7H9ClN2O — CID 122129593
3-chloro-4-methoxybenzene-1,2-diamine (PubChem CID 122129593) has the molecular formula C7H9ClN2O and a molecular weight of 172.62 g/mol. Its IUPAC name is 3-chloro-4-methoxybenzene-1,2-diamine.
| Compound Name | 3-chloro-4-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 122129593 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-chloro-4-methoxybenzene-1,2-diamine |
| SMILES | COc1ccc(N)c(N)c1Cl |
| InChI | InChI=1S/C7H9ClN2O/c1-11-5-3-2-4(9)7(10)6(5)8/h2-3H,9-10H2,1H3 |
| InChIKey | IYLBYXMDAQRPLF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|