C15H16ClNO2 — CID 107627279
3-(3-chloro-2,4-dimethoxyphenyl)-2-methylaniline (PubChem CID 107627279) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 3-(3-chloro-2,4-dimethoxyphenyl)-2-methylaniline.
| Compound Name | 3-(3-chloro-2,4-dimethoxyphenyl)-2-methylaniline |
|---|---|
| PubChem CID | 107627279 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-(3-chloro-2,4-dimethoxyphenyl)-2-methylaniline |
| SMILES | COc1ccc(-c2cccc(N)c2C)c(OC)c1Cl |
| InChI | InChI=1S/C15H16ClNO2/c1-9-10(5-4-6-12(9)17)11-7-8-13(18-2)14(16)15(11)19-3/h4-8H,17H2,1-3H3 |
| InChIKey | NGTNWXQPEARNIU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|