2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid

C15H12ClFO4 — CID 114560415

IUPAC2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid
SMILESCOc1ccc(-c2cccc(F)c2C(=O)O)c(OC)c1Cl
InChIInChI=1S/C15H12ClFO4/c1-20-11-7-6-9(14(21-2)13(11)16)8-4-3-5-10(17)12(8)15(18)19/h3-7H,1-2H3,(H,18,19)
InChIKeyNSTDUTFKHDOTNC-UHFFFAOYSA-N
MW310.71 g/mol
LogP3.86
Rot. Bonds4

About 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid

2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid (PubChem CID 114560415) has the molecular formula C15H12ClFO4 and a molecular weight of 310.71 g/mol. Its IUPAC name is 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid.

Molecular Properties

Compound Name2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid
PubChem CID114560415
Molecular FormulaC15H12ClFO4
Molecular Weight310.71 g/mol
Exact Mass310.04
IUPAC Name2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid
SMILESCOc1ccc(-c2cccc(F)c2C(=O)O)c(OC)c1Cl
InChIInChI=1S/C15H12ClFO4/c1-20-11-7-6-9(14(21-2)13(11)16)8-4-3-5-10(17)12(8)15(18)19/h3-7H,1-2H3,(H,18,19)
InChIKeyNSTDUTFKHDOTNC-UHFFFAOYSA-N
XLogP3.86
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.71
LogP ≤ 53.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid?
The IUPAC name of 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid (CID 114560415) is 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid.
What is the SMILES notation for 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid?
The canonical SMILES for 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid is COc1ccc(-c2cccc(F)c2C(=O)O)c(OC)c1Cl.
What is the InChIKey of 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid?
The InChIKey is NSTDUTFKHDOTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClFO4/c1-20-11-7-6-9(14(21-2)13(11)16)8-4-3-5-10(17)12(8)15(18)19/h3-7H,1-2H3,(H,18,19).
What are the key properties of 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid?
2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid has a molecular weight of 310.71 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-2,4-dimethoxyphenyl)-6-fluorobenzoic acid is sourced from PubChem (CID 114560415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).