3-chloro-2-fluoro-5,6-dimethoxybenzoic acid

C9H8ClFO4 — CID 117341260

IUPAC3-chloro-2-fluoro-5,6-dimethoxybenzoic acid
SMILESCOc1cc(Cl)c(F)c(C(=O)O)c1OC
InChIInChI=1S/C9H8ClFO4/c1-14-5-3-4(10)7(11)6(9(12)13)8(5)15-2/h3H,1-2H3,(H,12,13)
InChIKeyUBLMOSHCTQEWKM-UHFFFAOYSA-N
MW234.61 g/mol
LogP2.19
Rot. Bonds3

About 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid

3-chloro-2-fluoro-5,6-dimethoxybenzoic acid (PubChem CID 117341260) has the molecular formula C9H8ClFO4 and a molecular weight of 234.61 g/mol. Its IUPAC name is 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid.

Molecular Properties

Compound Name3-chloro-2-fluoro-5,6-dimethoxybenzoic acid
PubChem CID117341260
Molecular FormulaC9H8ClFO4
Molecular Weight234.61 g/mol
Exact Mass234.01
IUPAC Name3-chloro-2-fluoro-5,6-dimethoxybenzoic acid
SMILESCOc1cc(Cl)c(F)c(C(=O)O)c1OC
InChIInChI=1S/C9H8ClFO4/c1-14-5-3-4(10)7(11)6(9(12)13)8(5)15-2/h3H,1-2H3,(H,12,13)
InChIKeyUBLMOSHCTQEWKM-UHFFFAOYSA-N
XLogP2.19
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.61
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid?
The IUPAC name of 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid (CID 117341260) is 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid.
What is the SMILES notation for 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid?
The canonical SMILES for 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid is COc1cc(Cl)c(F)c(C(=O)O)c1OC.
What is the InChIKey of 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid?
The InChIKey is UBLMOSHCTQEWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClFO4/c1-14-5-3-4(10)7(11)6(9(12)13)8(5)15-2/h3H,1-2H3,(H,12,13).
What are the key properties of 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid?
3-chloro-2-fluoro-5,6-dimethoxybenzoic acid has a molecular weight of 234.61 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-fluoro-5,6-dimethoxybenzoic acid is sourced from PubChem (CID 117341260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).