C10H11ClFNO3 — CID 84706246
2-amino-1-(2-chloro-3-fluoro-5,6-dimethoxyphenyl)ethanone (PubChem CID 84706246) has the molecular formula C10H11ClFNO3 and a molecular weight of 247.65 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-3-fluoro-5,6-dimethoxyphenyl)ethanone.
| Compound Name | 2-amino-1-(2-chloro-3-fluoro-5,6-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 84706246 |
| Molecular Formula | C10H11ClFNO3 |
| Molecular Weight | 247.65 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-amino-1-(2-chloro-3-fluoro-5,6-dimethoxyphenyl)ethanone |
| SMILES | COc1cc(F)c(Cl)c(C(=O)CN)c1OC |
| InChI | InChI=1S/C10H11ClFNO3/c1-15-7-3-5(12)9(11)8(6(14)4-13)10(7)16-2/h3H,4,13H2,1-2H3 |
| InChIKey | YPZBBSUVJLDJBS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.65 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |