C15H12BrFO4 — CID 107957614
3-(3-bromo-2,4-dimethoxyphenyl)-2-fluorobenzoic acid (PubChem CID 107957614) has the molecular formula C15H12BrFO4 and a molecular weight of 355.16 g/mol. Its IUPAC name is 3-(3-bromo-2,4-dimethoxyphenyl)-2-fluorobenzoic acid.
| Compound Name | 3-(3-bromo-2,4-dimethoxyphenyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 107957614 |
| Molecular Formula | C15H12BrFO4 |
| Molecular Weight | 355.16 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 3-(3-bromo-2,4-dimethoxyphenyl)-2-fluorobenzoic acid |
| SMILES | COc1ccc(-c2cccc(C(=O)O)c2F)c(OC)c1Br |
| InChI | InChI=1S/C15H12BrFO4/c1-20-11-7-6-9(14(21-2)12(11)16)8-4-3-5-10(13(8)17)15(18)19/h3-7H,1-2H3,(H,18,19) |
| InChIKey | WPJNDMOLVOCHBH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.16 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |