C17H22O — CID 154338193
4-tert-butyl-3-methyl-4-phenylcyclohexa-1,5-dien-1-ol (PubChem CID 154338193) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-tert-butyl-3-methyl-4-phenylcyclohexa-1,5-dien-1-ol.
| Compound Name | 4-tert-butyl-3-methyl-4-phenylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 154338193 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 4-tert-butyl-3-methyl-4-phenylcyclohexa-1,5-dien-1-ol |
| SMILES | CC1C=C(O)C=CC1(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H22O/c1-13-12-15(18)10-11-17(13,16(2,3)4)14-8-6-5-7-9-14/h5-13,18H,1-4H3 |
| InChIKey | HKSCYXWRXHTFKX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |