C19H22O — CID 155289572
(1S,3S)-3-tert-butyl-1-methyl-3-phenyl-1H-2-benzofuran (PubChem CID 155289572) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is (1S,3S)-3-tert-butyl-1-methyl-3-phenyl-1H-2-benzofuran.
| Compound Name | (1S,3S)-3-tert-butyl-1-methyl-3-phenyl-1H-2-benzofuran |
|---|---|
| PubChem CID | 155289572 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (1S,3S)-3-tert-butyl-1-methyl-3-phenyl-1H-2-benzofuran |
| SMILES | C[C@@H]1O[C@](c2ccccc2)(C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H22O/c1-14-16-12-8-9-13-17(16)19(20-14,18(2,3)4)15-10-6-5-7-11-15/h5-14H,1-4H3/t14-,19-/m0/s1 |
| InChIKey | GUOUEHIWAIEAJX-LIRRHRJNSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |