C26H20O — CID 177491347
(1S,8R,9R,12S)-10,11-dimethylidene-1,8-diphenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-triene (PubChem CID 177491347) has the molecular formula C26H20O and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,8R,9R,12S)-10,11-dimethylidene-1,8-diphenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-triene.
| Compound Name | (1S,8R,9R,12S)-10,11-dimethylidene-1,8-diphenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 177491347 |
| Molecular Formula | C26H20O |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (1S,8R,9R,12S)-10,11-dimethylidene-1,8-diphenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-triene |
| SMILES | C=C1C(=C)[C@H]2[C@@H]1[C@@]1(c3ccccc3)O[C@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H20O/c1-17-18(2)24-23(17)25(19-11-5-3-6-12-19)21-15-9-10-16-22(21)26(24,27-25)20-13-7-4-8-14-20/h3-16,23-24H,1-2H2/t23-,24+,25+,26- |
| InChIKey | QPHHECKFOUFLNV-FATVKVNYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |