C24H20O3S — CID 98554881
(1R,8R,9S,13S)-1,8-diphenyl-14-oxa-11λ6-thiatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene 11,11-dioxide (PubChem CID 98554881) has the molecular formula C24H20O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is (1R,8R,9S,13S)-1,8-diphenyl-14-oxa-11λ6-thiatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene 11,11-dioxide.
| Compound Name | (1R,8R,9S,13S)-1,8-diphenyl-14-oxa-11λ6-thiatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene 11,11-dioxide |
|---|---|
| PubChem CID | 98554881 |
| Molecular Formula | C24H20O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (1R,8R,9S,13S)-1,8-diphenyl-14-oxa-11λ6-thiatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene 11,11-dioxide |
| SMILES | O=S1(=O)C[C@H]2[C@H](C1)[C@]1(c3ccccc3)O[C@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H20O3S/c25-28(26)15-21-22(16-28)24(18-11-5-2-6-12-18)20-14-8-7-13-19(20)23(21,27-24)17-9-3-1-4-10-17/h1-14,21-22H,15-16H2/t21-,22-,23+,24+/m0/s1 |
| InChIKey | PCFRRWOHRVAVDS-CJRSTVEYSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |