C28H22O — CID 13272549
(1S,2S,3R,8S,9R,10R)-1,10-diphenyl-17-oxapentacyclo[8.6.1.02,9.03,8.011,16]heptadeca-4,6,11,13,15-pentaene (PubChem CID 13272549) has the molecular formula C28H22O and a molecular weight of 374.48 g/mol. Its IUPAC name is (1S,2S,3R,8S,9R,10R)-1,10-diphenyl-17-oxapentacyclo[8.6.1.02,9.03,8.011,16]heptadeca-4,6,11,13,15-pentaene.
| Compound Name | (1S,2S,3R,8S,9R,10R)-1,10-diphenyl-17-oxapentacyclo[8.6.1.02,9.03,8.011,16]heptadeca-4,6,11,13,15-pentaene |
|---|---|
| PubChem CID | 13272549 |
| Molecular Formula | C28H22O |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1S,2S,3R,8S,9R,10R)-1,10-diphenyl-17-oxapentacyclo[8.6.1.02,9.03,8.011,16]heptadeca-4,6,11,13,15-pentaene |
| SMILES | C1=C[C@@H]2[C@H](C=C1)[C@@H]1[C@H]2[C@@]2(c3ccccc3)O[C@]1(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C28H22O/c1-3-11-19(12-4-1)27-23-17-9-10-18-24(23)28(29-27,20-13-5-2-6-14-20)26-22-16-8-7-15-21(22)25(26)27/h1-18,21-22,25-26H/t21-,22+,25+,26-,27+,28- |
| InChIKey | DKHODCDLJPYBFX-FPZITIEKSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'} |
|---|