C36H36O3SSi — CID 125033909
[(1S,2S,3S,4R,5R,6S,7S,8S)-5-(benzenesulfonyl)-1,8-diphenyl-15-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-9,11,13-trien-4-yl]-trimethylsilane (PubChem CID 125033909) has the molecular formula C36H36O3SSi and a molecular weight of 576.83 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5R,6S,7S,8S)-5-(benzenesulfonyl)-1,8-diphenyl-15-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-9,11,13-trien-4-yl]-trimethylsilane.
| Compound Name | [(1S,2S,3S,4R,5R,6S,7S,8S)-5-(benzenesulfonyl)-1,8-diphenyl-15-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-9,11,13-trien-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 125033909 |
| Molecular Formula | C36H36O3SSi |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | [(1S,2S,3S,4R,5R,6S,7S,8S)-5-(benzenesulfonyl)-1,8-diphenyl-15-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-9,11,13-trien-4-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)[C@@H]1[C@H]2C[C@@H]([C@@H]3[C@@H]2[C@@]2(c4ccccc4)O[C@@]3(c3ccccc3)c3ccccc32)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H36O3SSi/c1-41(2,3)34-28-23-27(33(34)40(37,38)26-19-11-6-12-20-26)31-32(28)36(25-17-9-5-10-18-25)30-22-14-13-21-29(30)35(31,39-36)24-15-7-4-8-16-24/h4-22,27-28,31-34H,23H2,1-3H3/t27-,28-,31+,32+,33+,34+,35-,36-/m0/s1 |
| InChIKey | FQCBDNNMSJJMQP-IXJJRVACSA-N |
| XLogP | 7.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|