C36H44O2Si — CID 132937477
tert-butyl-[[(2S,5R,7S,10S)-1,11-diphenyl-18-oxapentacyclo[9.6.1.02,10.05,7.012,17]octadeca-12,14,16-trien-6-yl]methoxy]-dimethylsilane (PubChem CID 132937477) has the molecular formula C36H44O2Si and a molecular weight of 536.83 g/mol. Its IUPAC name is tert-butyl-[[(2S,5R,7S,10S)-1,11-diphenyl-18-oxapentacyclo[9.6.1.02,10.05,7.012,17]octadeca-12,14,16-trien-6-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,5R,7S,10S)-1,11-diphenyl-18-oxapentacyclo[9.6.1.02,10.05,7.012,17]octadeca-12,14,16-trien-6-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 132937477 |
| Molecular Formula | C36H44O2Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | tert-butyl-[[(2S,5R,7S,10S)-1,11-diphenyl-18-oxapentacyclo[9.6.1.02,10.05,7.012,17]octadeca-12,14,16-trien-6-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1[C@H]2CC[C@H]3[C@H](CC[C@@H]12)C1(c2ccccc2)OC3(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C36H44O2Si/c1-34(2,3)39(4,5)37-24-29-27-20-22-32-33(23-21-28(27)29)36(26-16-10-7-11-17-26)31-19-13-12-18-30(31)35(32,38-36)25-14-8-6-9-15-25/h6-19,27-29,32-33H,20-24H2,1-5H3/t27-,28+,29?,32-,33-,35?,36?/m0/s1 |
| InChIKey | DKCSIQOAYJKRFZ-RRUFTFMASA-N |
| XLogP | 8.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|