C19H20O3 — CID 134937131
(1R,9R)-8-tert-butyl-9-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 134937131) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (1R,9R)-8-tert-butyl-9-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1R,9R)-8-tert-butyl-9-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 134937131 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (1R,9R)-8-tert-butyl-9-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | CC(C)(C)C1c2ccccc2[C@H]2OO[C@]1(c1ccccc1)O2 |
| InChI | InChI=1S/C19H20O3/c1-18(2,3)16-14-11-7-8-12-15(14)17-20-19(16,22-21-17)13-9-5-4-6-10-13/h4-12,16-17H,1-3H3/t16?,17-,19+/m1/s1 |
| InChIKey | UDDNOIWCNUKVQS-QIONWKSUSA-N |
| XLogP | 4.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|