C17H16O3 — CID 134938097
(1S,9S)-8-ethyl-9-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 134938097) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,9S)-8-ethyl-9-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9S)-8-ethyl-9-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 134938097 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1S,9S)-8-ethyl-9-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | CCC1c2ccccc2[C@@H]2OO[C@@]1(c1ccccc1)O2 |
| InChI | InChI=1S/C17H16O3/c1-2-15-13-10-6-7-11-14(13)16-18-17(15,20-19-16)12-8-4-3-5-9-12/h3-11,15-16H,2H2,1H3/t15?,16-,17+/m0/s1 |
| InChIKey | ZHVHZPIWLPEZLO-LRUHZDSUSA-N |
| XLogP | 4.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|