C19H20O — CID 100968951
(1S,3S)-1,3-diethyl-3-phenyl-1H-inden-2-one (PubChem CID 100968951) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is (1S,3S)-1,3-diethyl-3-phenyl-1H-inden-2-one.
| Compound Name | (1S,3S)-1,3-diethyl-3-phenyl-1H-inden-2-one |
|---|---|
| PubChem CID | 100968951 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1S,3S)-1,3-diethyl-3-phenyl-1H-inden-2-one |
| SMILES | CC[C@@H]1C(=O)[C@@](CC)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H20O/c1-3-15-16-12-8-9-13-17(16)19(4-2,18(15)20)14-10-6-5-7-11-14/h5-13,15H,3-4H2,1-2H3/t15-,19-/m0/s1 |
| InChIKey | IMLWEDNIOMYDRY-KXBFYZLASA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |