C28H32N4O8 — CID 139042175
1,4-dioxane;bis(5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione) (PubChem CID 139042175) has the molecular formula C28H32N4O8 and a molecular weight of 552.58 g/mol. Its IUPAC name is 1,4-dioxane;bis(5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione).
| Compound Name | 1,4-dioxane;bis(5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione) |
|---|---|
| PubChem CID | 139042175 |
| Molecular Formula | C28H32N4O8 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 1,4-dioxane;bis(5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione) |
| SMILES | C1COCCO1.CCC1(c2ccccc2)C(=O)NC(=O)NC1=O.CCC1(c2ccccc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/2C12H12N2O3.C4H8O2/c2*1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;1-2-6-4-3-5-1/h2*3-7H,2H2,1H3,(H2,13,14,15,16,17);1-4H2 |
| InChIKey | GUMADVIZEVLKFP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|