C12H10N4O7 — CID 71372442
5-(3,4-dinitrophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 71372442) has the molecular formula C12H10N4O7 and a molecular weight of 322.23 g/mol. Its IUPAC name is 5-(3,4-dinitrophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(3,4-dinitrophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 71372442 |
| Molecular Formula | C12H10N4O7 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-(3,4-dinitrophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(c2ccc([N+](=O)[O-])c([N+](=O)[O-])c2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C12H10N4O7/c1-2-12(9(17)13-11(19)14-10(12)18)6-3-4-7(15(20)21)8(5-6)16(22)23/h3-5H,2H2,1H3,(H2,13,14,17,18,19) |
| InChIKey | AMFTWXSQTORDRK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|