C12H15N3O4 — CID 144913262
ethane;5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 144913262) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is ethane;5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | ethane;5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 144913262 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | ethane;5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | CC.CC1(c2ccc([N+](=O)[O-])cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C10H9N3O4.C2H6/c1-10(8(14)11-9(15)12-10)6-2-4-7(5-3-6)13(16)17;1-2/h2-5H,1H3,(H2,11,12,14,15);1-2H3 |
| InChIKey | OFBMOXVDGDUZIT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|