C16H14N4O6S — CID 55735673
N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-4-nitrobenzenesulfonamide (PubChem CID 55735673) has the molecular formula C16H14N4O6S and a molecular weight of 390.38 g/mol. Its IUPAC name is N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55735673 |
| Molecular Formula | C16H14N4O6S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-4-nitrobenzenesulfonamide |
| SMILES | CC1(c2cccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C16H14N4O6S/c1-16(14(21)17-15(22)18-16)10-3-2-4-11(9-10)19-27(25,26)13-7-5-12(6-8-13)20(23)24/h2-9,19H,1H3,(H2,17,18,21,22) |
| InChIKey | JRENRKXEUZHYSA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|