C12H13N4O6PS — CID 23341646
N-(3-diaminophosphoryloxyphenyl)-4-nitrobenzenesulfonamide (PubChem CID 23341646) has the molecular formula C12H13N4O6PS and a molecular weight of 372.30 g/mol. Its IUPAC name is N-(3-diaminophosphoryloxyphenyl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(3-diaminophosphoryloxyphenyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 23341646 |
| Molecular Formula | C12H13N4O6PS |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | N-(3-diaminophosphoryloxyphenyl)-4-nitrobenzenesulfonamide |
| SMILES | NP(N)(=O)Oc1cccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C12H13N4O6PS/c13-23(14,19)22-11-3-1-2-9(8-11)15-24(20,21)12-6-4-10(5-7-12)16(17)18/h1-8,15H,(H4,13,14,19) |
| InChIKey | RNHBILVVHHPJAD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 167.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|