C18H16N4O6 — CID 55722650
N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-(2-nitrophenoxy)acetamide (PubChem CID 55722650) has the molecular formula C18H16N4O6 and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 55722650 |
| Molecular Formula | C18H16N4O6 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-(2-nitrophenoxy)acetamide |
| SMILES | CC1(c2cccc(NC(=O)COc3ccccc3[N+](=O)[O-])c2)NC(=O)NC1=O |
| InChI | InChI=1S/C18H16N4O6/c1-18(16(24)20-17(25)21-18)11-5-4-6-12(9-11)19-15(23)10-28-14-8-3-2-7-13(14)22(26)27/h2-9H,10H2,1H3,(H,19,23)(H2,20,21,24,25) |
| InChIKey | AYEPMMGOUAEICG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|