C17H14N4O6S — CID 55735768
N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 55735768) has the molecular formula C17H14N4O6S and a molecular weight of 402.39 g/mol. Its IUPAC name is N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 55735768 |
| Molecular Formula | C17H14N4O6S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | CC1(c2cccc(NS(=O)(=O)c3ccc4[nH]c(=O)oc4c3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H14N4O6S/c1-17(14(22)19-15(23)20-17)9-3-2-4-10(7-9)21-28(25,26)11-5-6-12-13(8-11)27-16(24)18-12/h2-8,21H,1H3,(H,18,24)(H2,19,20,22,23) |
| InChIKey | GYYIFGRGRVCDDB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 150.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|