C12H12N2O5 — CID 124523212
2-[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]acetic acid (PubChem CID 124523212) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 124523212 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]acetic acid |
| SMILES | C[C@@]1(c2ccc(OCC(=O)O)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C12H12N2O5/c1-12(10(17)13-11(18)14-12)7-2-4-8(5-3-7)19-6-9(15)16/h2-5H,6H2,1H3,(H,15,16)(H2,13,14,17,18)/t12-/m0/s1 |
| InChIKey | HIADXVDECGUWJV-LBPRGKRZSA-N |
| XLogP | 0.20 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|