About 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide
2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide (PubChem CID 2385071) has the molecular formula C21H23N3O4
and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide |
| PubChem CID | 2385071 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C(=O)COc1ccc([C@@]2(C)NC(=O)NC2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O4/c1-14(2)24(16-7-5-4-6-8-16)18(25)13-28-17-11-9-15(10-12-17)21(3)19(26)22-20(27)23-21/h4-12,14H,13H2,1-3H3,(H2,22,23,26,27)/t21-/m1/s1 |
| InChIKey | HRPYVCDEPGGMAT-OAQYLSRUSA-N |
| XLogP | 2.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide?
The IUPAC name of 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide (CID 2385071) is 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide?
The canonical SMILES for 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide is CC(C)N(C(=O)COc1ccc([C@@]2(C)NC(=O)NC2=O)cc1)c1ccccc1.
What is the InChIKey of 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide?
The InChIKey is HRPYVCDEPGGMAT-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H23N3O4/c1-14(2)24(16-7-5-4-6-8-16)18(25)13-28-17-11-9-15(10-12-17)21(3)19(26)22-20(27)23-21/h4-12,14H,13H2,1-3H3,(H2,22,23,26,27)/t21-/m1/s1.
What are the key properties of 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide?
2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide has a molecular weight of 381.43 g/mol, XLogP of 2.56, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]-N-phenyl-N-propan-2-ylacetamide is sourced from PubChem (CID 2385071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).