About 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide
2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide (PubChem CID 112788150) has the molecular formula C19H22FNO4
and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide |
| PubChem CID | 112788150 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C(=O)COc1c(CO)cc(F)cc1CO)c1ccccc1 |
| InChI | InChI=1S/C19H22FNO4/c1-13(2)21(17-6-4-3-5-7-17)18(24)12-25-19-14(10-22)8-16(20)9-15(19)11-23/h3-9,13,22-23H,10-12H2,1-2H3 |
| InChIKey | MQFCIJWJELIGJK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide?
The IUPAC name of 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide (CID 112788150) is 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide?
The canonical SMILES for 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide is CC(C)N(C(=O)COc1c(CO)cc(F)cc1CO)c1ccccc1.
What is the InChIKey of 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide?
The InChIKey is MQFCIJWJELIGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNO4/c1-13(2)21(17-6-4-3-5-7-17)18(24)12-25-19-14(10-22)8-16(20)9-15(19)11-23/h3-9,13,22-23H,10-12H2,1-2H3.
What are the key properties of 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide?
2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide has a molecular weight of 347.39 g/mol, XLogP of 2.63, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-fluoro-2,6-bis(hydroxymethyl)phenoxy]-N-phenyl-N-propan-2-ylacetamide is sourced from PubChem (CID 112788150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).